C49H95NO5 — CID 170022824
6-[6-[(E)-2-hexyldec-3-enoyl]oxyhexyl-(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate (PubChem CID 170022824) has the molecular formula C49H95NO5 and a molecular weight of 778.30 g/mol. Its IUPAC name is 6-[6-[(E)-2-hexyldec-3-enoyl]oxyhexyl-(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-[(E)-2-hexyldec-3-enoyl]oxyhexyl-(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 170022824 |
| Molecular Formula | C49H95NO5 |
| Molecular Weight | 778.30 g/mol |
| Exact Mass | 777.72 |
| IUPAC Name | 6-[6-[(E)-2-hexyldec-3-enoyl]oxyhexyl-(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCC/C=C/C(CCCCCC)C(=O)OCCCCCCN(CCCCCO)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C49H95NO5/c1-5-9-13-17-19-28-38-46(36-26-15-11-7-3)48(52)54-44-34-23-21-30-40-50(42-32-25-33-43-51)41-31-22-24-35-45-55-49(53)47(37-27-16-12-8-4)39-29-20-18-14-10-6-2/h28,38,46-47,51H,5-27,29-37,39-45H2,1-4H3/b38-28+ |
| InChIKey | BEIWGPRTAGCONQ-HXPUERGNSA-N |
| XLogP | 14.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.30 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|