C17H36N2O2 — CID 102118885
N-[[ethyl(9-hydroxynonyl)amino]methyl]pentanamide (PubChem CID 102118885) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N-[[ethyl(9-hydroxynonyl)amino]methyl]pentanamide.
| Compound Name | N-[[ethyl(9-hydroxynonyl)amino]methyl]pentanamide |
|---|---|
| PubChem CID | 102118885 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | N-[[ethyl(9-hydroxynonyl)amino]methyl]pentanamide |
| SMILES | CCCCC(=O)NCN(CC)CCCCCCCCCO |
| InChI | InChI=1S/C17H36N2O2/c1-3-5-13-17(21)18-16-19(4-2)14-11-9-7-6-8-10-12-15-20/h20H,3-16H2,1-2H3,(H,18,21) |
| InChIKey | YNOCYROPSONHEB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|