C18H36N2O2 — CID 101274750
(E)-N-[[ethyl(8-hydroxyoctyl)amino]methyl]hept-5-enamide (PubChem CID 101274750) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (E)-N-[[ethyl(8-hydroxyoctyl)amino]methyl]hept-5-enamide.
| Compound Name | (E)-N-[[ethyl(8-hydroxyoctyl)amino]methyl]hept-5-enamide |
|---|---|
| PubChem CID | 101274750 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (E)-N-[[ethyl(8-hydroxyoctyl)amino]methyl]hept-5-enamide |
| SMILES | C/C=C/CCCC(=O)NCN(CC)CCCCCCCCO |
| InChI | InChI=1S/C18H36N2O2/c1-3-5-6-11-14-18(22)19-17-20(4-2)15-12-9-7-8-10-13-16-21/h3,5,21H,4,6-17H2,1-2H3,(H,19,22)/b5-3+ |
| InChIKey | IPGUFDRNPRLUDP-HWKANZROSA-N |
| XLogP | 3.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|