C24H49N3O2 — CID 102116497
N-[3-[ethyl-[3-(octanoylamino)propyl]amino]propyl]octanamide (PubChem CID 102116497) has the molecular formula C24H49N3O2 and a molecular weight of 411.68 g/mol. Its IUPAC name is N-[3-[ethyl-[3-(octanoylamino)propyl]amino]propyl]octanamide.
| Compound Name | N-[3-[ethyl-[3-(octanoylamino)propyl]amino]propyl]octanamide |
|---|---|
| PubChem CID | 102116497 |
| Molecular Formula | C24H49N3O2 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.38 |
| IUPAC Name | N-[3-[ethyl-[3-(octanoylamino)propyl]amino]propyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCCN(CC)CCCNC(=O)CCCCCCC |
| InChI | InChI=1S/C24H49N3O2/c1-4-7-9-11-13-17-23(28)25-19-15-21-27(6-3)22-16-20-26-24(29)18-14-12-10-8-5-2/h4-22H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | LXNCWRSHFIUMGN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|