About ethane;N-octylhexanamide
ethane;N-octylhexanamide (PubChem CID 177149935) has the molecular formula C20H47NO
and a molecular weight of 317.60 g/mol. Its IUPAC name is ethane;N-octylhexanamide.
Molecular Properties
| Compound Name | ethane;N-octylhexanamide |
| PubChem CID | 177149935 |
| Molecular Formula | C20H47NO |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 317.37 |
| IUPAC Name | ethane;N-octylhexanamide |
| SMILES | CC.CC.CC.CCCCCCCCNC(=O)CCCCC |
| InChI | InChI=1S/C14H29NO.3C2H6/c1-3-5-7-8-9-11-13-15-14(16)12-10-6-4-2;3*1-2/h3-13H2,1-2H3,(H,15,16);3*1-2H3 |
| InChIKey | HQEJOPSTDIRIEB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-octylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-octylhexanamide?
The IUPAC name of ethane;N-octylhexanamide (CID 177149935) is ethane;N-octylhexanamide.
What is the SMILES notation for ethane;N-octylhexanamide?
The canonical SMILES for ethane;N-octylhexanamide is CC.CC.CC.CCCCCCCCNC(=O)CCCCC.
What is the InChIKey of ethane;N-octylhexanamide?
The InChIKey is HQEJOPSTDIRIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO.3C2H6/c1-3-5-7-8-9-11-13-15-14(16)12-10-6-4-2;3*1-2/h3-13H2,1-2H3,(H,15,16);3*1-2H3.
What are the key properties of ethane;N-octylhexanamide?
ethane;N-octylhexanamide has a molecular weight of 317.60 g/mol, XLogP of 7.12, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-octylhexanamide is sourced from PubChem (CID 177149935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).