About ethane;N-heptylhexadecanamide
ethane;N-heptylhexadecanamide (PubChem CID 142440540) has the molecular formula C25H53NO
and a molecular weight of 383.71 g/mol. Its IUPAC name is ethane;N-heptylhexadecanamide.
Molecular Properties
| Compound Name | ethane;N-heptylhexadecanamide |
| PubChem CID | 142440540 |
| Molecular Formula | C25H53NO |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 383.41 |
| IUPAC Name | ethane;N-heptylhexadecanamide |
| SMILES | CC.CCCCCCCCCCCCCCCC(=O)NCCCCCCC |
| InChI | InChI=1S/C23H47NO.C2H6/c1-3-5-7-9-10-11-12-13-14-15-16-17-19-21-23(25)24-22-20-18-8-6-4-2;1-2/h3-22H2,1-2H3,(H,24,25);1-2H3 |
| InChIKey | PMGUTMXMGQEHDF-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-heptylhexadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-heptylhexadecanamide?
The IUPAC name of ethane;N-heptylhexadecanamide (CID 142440540) is ethane;N-heptylhexadecanamide.
What is the SMILES notation for ethane;N-heptylhexadecanamide?
The canonical SMILES for ethane;N-heptylhexadecanamide is CC.CCCCCCCCCCCCCCCC(=O)NCCCCCCC.
What is the InChIKey of ethane;N-heptylhexadecanamide?
The InChIKey is PMGUTMXMGQEHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H47NO.C2H6/c1-3-5-7-9-10-11-12-13-14-15-16-17-19-21-23(25)24-22-20-18-8-6-4-2;1-2/h3-22H2,1-2H3,(H,24,25);1-2H3.
What are the key properties of ethane;N-heptylhexadecanamide?
ethane;N-heptylhexadecanamide has a molecular weight of 383.71 g/mol, XLogP of 8.58, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-heptylhexadecanamide is sourced from PubChem (CID 142440540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).