About N-tetradecyloctanamide
N-tetradecyloctanamide (PubChem CID 151737522) has the molecular formula C22H45NO
and a molecular weight of 339.61 g/mol. Its IUPAC name is N-tetradecyloctanamide.
Molecular Properties
| Compound Name | N-tetradecyloctanamide |
| PubChem CID | 151737522 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | N-tetradecyloctanamide |
| SMILES | CCCCCCCCCCCCCCNC(=O)CCCCCCC |
| InChI | InChI=1S/C22H45NO/c1-3-5-7-9-10-11-12-13-14-15-17-19-21-23-22(24)20-18-16-8-6-4-2/h3-21H2,1-2H3,(H,23,24) |
| InChIKey | RLVMALYWEMDTIZ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tetradecyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tetradecyloctanamide?
The IUPAC name of N-tetradecyloctanamide (CID 151737522) is N-tetradecyloctanamide.
What is the SMILES notation for N-tetradecyloctanamide?
The canonical SMILES for N-tetradecyloctanamide is CCCCCCCCCCCCCCNC(=O)CCCCCCC.
What is the InChIKey of N-tetradecyloctanamide?
The InChIKey is RLVMALYWEMDTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45NO/c1-3-5-7-9-10-11-12-13-14-15-17-19-21-23-22(24)20-18-16-8-6-4-2/h3-21H2,1-2H3,(H,23,24).
What are the key properties of N-tetradecyloctanamide?
N-tetradecyloctanamide has a molecular weight of 339.61 g/mol, XLogP of 7.16, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tetradecyloctanamide is sourced from PubChem (CID 151737522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).