About N-dodecylhexanamide
N-dodecylhexanamide (PubChem CID 3362981) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is N-dodecylhexanamide.
Molecular Properties
| Compound Name | N-dodecylhexanamide |
| PubChem CID | 3362981 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-dodecylhexanamide |
| SMILES | CCCCCCCCCCCCNC(=O)CCCCC |
| InChI | InChI=1S/C18H37NO/c1-3-5-7-8-9-10-11-12-13-15-17-19-18(20)16-14-6-4-2/h3-17H2,1-2H3,(H,19,20) |
| InChIKey | FRXNAPZQPAEJOL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-dodecylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dodecylhexanamide?
The IUPAC name of N-dodecylhexanamide (CID 3362981) is N-dodecylhexanamide.
What is the SMILES notation for N-dodecylhexanamide?
The canonical SMILES for N-dodecylhexanamide is CCCCCCCCCCCCNC(=O)CCCCC.
What is the InChIKey of N-dodecylhexanamide?
The InChIKey is FRXNAPZQPAEJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-3-5-7-8-9-10-11-12-13-15-17-19-18(20)16-14-6-4-2/h3-17H2,1-2H3,(H,19,20).
What are the key properties of N-dodecylhexanamide?
N-dodecylhexanamide has a molecular weight of 283.50 g/mol, XLogP of 5.60, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-dodecylhexanamide is sourced from PubChem (CID 3362981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).