C20H40N2O2 — CID 102117853
(E)-N-[2-[2-hydroxyethyl(octyl)amino]ethyl]oct-4-enamide (PubChem CID 102117853) has the molecular formula C20H40N2O2 and a molecular weight of 340.55 g/mol. Its IUPAC name is (E)-N-[2-[2-hydroxyethyl(octyl)amino]ethyl]oct-4-enamide.
| Compound Name | (E)-N-[2-[2-hydroxyethyl(octyl)amino]ethyl]oct-4-enamide |
|---|---|
| PubChem CID | 102117853 |
| Molecular Formula | C20H40N2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (E)-N-[2-[2-hydroxyethyl(octyl)amino]ethyl]oct-4-enamide |
| SMILES | CCC/C=C/CCC(=O)NCCN(CCO)CCCCCCCC |
| InChI | InChI=1S/C20H40N2O2/c1-3-5-7-9-11-13-16-22(18-19-23)17-15-21-20(24)14-12-10-8-6-4-2/h8,10,23H,3-7,9,11-19H2,1-2H3,(H,21,24)/b10-8+ |
| InChIKey | IGBSAEXZLRGBFD-CSKARUKUSA-N |
| XLogP | 3.89 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|