C22H41N3O3 — CID 101285699
(E)-N-[2-[2-hydroxyethyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide (PubChem CID 101285699) has the molecular formula C22H41N3O3 and a molecular weight of 395.59 g/mol. Its IUPAC name is (E)-N-[2-[2-hydroxyethyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide.
| Compound Name | (E)-N-[2-[2-hydroxyethyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide |
|---|---|
| PubChem CID | 101285699 |
| Molecular Formula | C22H41N3O3 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | (E)-N-[2-[2-hydroxyethyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide |
| SMILES | CCCC/C=C/CC(=O)NCCN(CCO)CCNC(=O)C/C=C/CCCC |
| InChI | InChI=1S/C22H41N3O3/c1-3-5-7-9-11-13-21(27)23-15-17-25(19-20-26)18-16-24-22(28)14-12-10-8-6-4-2/h9-12,26H,3-8,13-20H2,1-2H3,(H,23,27)(H,24,28)/b11-9+,12-10+ |
| InChIKey | XIWHLNOAUBUMMG-WGDLNXRISA-N |
| XLogP | 2.79 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|