C25H47N3O3 — CID 101285811
(E)-N-[2-[3-hydroxypropyl-[1-[[(E)-oct-3-enoyl]amino]propan-2-yl]amino]propyl]oct-3-enamide (PubChem CID 101285811) has the molecular formula C25H47N3O3 and a molecular weight of 437.67 g/mol. Its IUPAC name is (E)-N-[2-[3-hydroxypropyl-[1-[[(E)-oct-3-enoyl]amino]propan-2-yl]amino]propyl]oct-3-enamide.
| Compound Name | (E)-N-[2-[3-hydroxypropyl-[1-[[(E)-oct-3-enoyl]amino]propan-2-yl]amino]propyl]oct-3-enamide |
|---|---|
| PubChem CID | 101285811 |
| Molecular Formula | C25H47N3O3 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.36 |
| IUPAC Name | (E)-N-[2-[3-hydroxypropyl-[1-[[(E)-oct-3-enoyl]amino]propan-2-yl]amino]propyl]oct-3-enamide |
| SMILES | CCCC/C=C/CC(=O)NCC(C)N(CCCO)C(C)CNC(=O)C/C=C/CCCC |
| InChI | InChI=1S/C25H47N3O3/c1-5-7-9-11-13-16-24(30)26-20-22(3)28(18-15-19-29)23(4)21-27-25(31)17-14-12-10-8-6-2/h11-14,22-23,29H,5-10,15-21H2,1-4H3,(H,26,30)(H,27,31)/b13-11+,14-12+ |
| InChIKey | FESOMCCKTJQJCR-PHEQNACWSA-N |
| XLogP | 3.95 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|