C27H49N3O3 — CID 102117758
(E)-N-[3-[3-[[(E)-non-3-enoyl]amino]propyl-(oxiran-2-ylmethyl)amino]propyl]non-3-enamide (PubChem CID 102117758) has the molecular formula C27H49N3O3 and a molecular weight of 463.71 g/mol. Its IUPAC name is (E)-N-[3-[3-[[(E)-non-3-enoyl]amino]propyl-(oxiran-2-ylmethyl)amino]propyl]non-3-enamide.
| Compound Name | (E)-N-[3-[3-[[(E)-non-3-enoyl]amino]propyl-(oxiran-2-ylmethyl)amino]propyl]non-3-enamide |
|---|---|
| PubChem CID | 102117758 |
| Molecular Formula | C27H49N3O3 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.38 |
| IUPAC Name | (E)-N-[3-[3-[[(E)-non-3-enoyl]amino]propyl-(oxiran-2-ylmethyl)amino]propyl]non-3-enamide |
| SMILES | CCCCC/C=C/CC(=O)NCCCN(CCCNC(=O)C/C=C/CCCCC)CC1CO1 |
| InChI | InChI=1S/C27H49N3O3/c1-3-5-7-9-11-13-17-26(31)28-19-15-21-30(23-25-24-33-25)22-16-20-29-27(32)18-14-12-10-8-6-4-2/h11-14,25H,3-10,15-24H2,1-2H3,(H,28,31)(H,29,32)/b13-11+,14-12+ |
| InChIKey | GUTNACPGOZUWID-PHEQNACWSA-N |
| XLogP | 4.75 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|