C25H45N3O3 — CID 102117725
(E)-N-[2-[2-[[(E)-non-6-enoyl]amino]ethyl-(oxiran-2-ylmethyl)amino]ethyl]non-6-enamide (PubChem CID 102117725) has the molecular formula C25H45N3O3 and a molecular weight of 435.65 g/mol. Its IUPAC name is (E)-N-[2-[2-[[(E)-non-6-enoyl]amino]ethyl-(oxiran-2-ylmethyl)amino]ethyl]non-6-enamide.
| Compound Name | (E)-N-[2-[2-[[(E)-non-6-enoyl]amino]ethyl-(oxiran-2-ylmethyl)amino]ethyl]non-6-enamide |
|---|---|
| PubChem CID | 102117725 |
| Molecular Formula | C25H45N3O3 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.35 |
| IUPAC Name | (E)-N-[2-[2-[[(E)-non-6-enoyl]amino]ethyl-(oxiran-2-ylmethyl)amino]ethyl]non-6-enamide |
| SMILES | CC/C=C/CCCCC(=O)NCCN(CCNC(=O)CCCC/C=C/CC)CC1CO1 |
| InChI | InChI=1S/C25H45N3O3/c1-3-5-7-9-11-13-15-24(29)26-17-19-28(21-23-22-31-23)20-18-27-25(30)16-14-12-10-8-6-4-2/h5-8,23H,3-4,9-22H2,1-2H3,(H,26,29)(H,27,30)/b7-5+,8-6+ |
| InChIKey | GPUZBRHAKGQQTL-KQQUZDAGSA-N |
| XLogP | 3.97 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|