C22H36N2O — CID 86696154
(5Z,8Z,11Z,14Z,17Z)-N-(2-aminoethyl)icosa-5,8,11,14,17-pentaenamide (PubChem CID 86696154) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-(2-aminoethyl)icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-(2-aminoethyl)icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 86696154 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-(2-aminoethyl)icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCN |
| InChI | InChI=1S/C22H36N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)24-21-20-23/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-21,23H2,1H3,(H,24,25)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | ZPDXZQNALJRRJE-JLNKQSITSA-N |
| XLogP | 4.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|