C28H48N4O — CID 123821068
N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123821068) has the molecular formula C28H48N4O and a molecular weight of 456.72 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123821068 |
| Molecular Formula | C28H48N4O |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNCCNCCN |
| InChI | InChI=1S/C28H48N4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(33)32-27-26-31-25-24-30-23-22-29/h3-4,6-7,9-10,12-13,15-16,18-19,30-31H,2,5,8,11,14,17,20-27,29H2,1H3,(H,32,33) |
| InChIKey | JWSJTOMNKJALGL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|