C30H45N3O4 — CID 129202482
(E)-4-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 129202482) has the molecular formula C30H45N3O4 and a molecular weight of 511.71 g/mol. Its IUPAC name is (E)-4-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 129202482 |
| Molecular Formula | C30H45N3O4 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | (E)-4-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C30H45N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(34)32-26-24-31-25-27-33-29(35)22-23-30(36)37/h3-4,6-7,9-10,12-13,15-16,18-19,22-23,31H,2,5,8,11,14,17,20-21,24-27H2,1H3,(H,32,34)(H,33,35)(H,36,37)/b4-3?,7-6?,10-9?,13-12?,16-15?,19-18?,23-22+ |
| InChIKey | PFEIEJMMMBTJGT-VATAASCOSA-N |
| XLogP | 4.93 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|