C33H50N4O4 — CID 123519386
4-[[3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-piperazin-1-ylpropyl]amino]-4-oxobut-2-enoic acid (PubChem CID 123519386) has the molecular formula C33H50N4O4 and a molecular weight of 566.79 g/mol. Its IUPAC name is 4-[[3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-piperazin-1-ylpropyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-piperazin-1-ylpropyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 123519386 |
| Molecular Formula | C33H50N4O4 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 4-[[3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-piperazin-1-ylpropyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCC(CNC(=O)C=CC(=O)O)N1CCNCC1 |
| InChI | InChI=1S/C33H50N4O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-31(38)35-28-30(37-26-24-34-25-27-37)29-36-32(39)22-23-33(40)41/h3-4,6-7,9-10,12-13,15-16,18-19,22-23,30,34H,2,5,8,11,14,17,20-21,24-29H2,1H3,(H,35,38)(H,36,39)(H,40,41) |
| InChIKey | ICPUUWOHDREWBK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|