C41H56N4O4 — CID 67092953
N-[3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-piperazin-1-ylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide (PubChem CID 67092953) has the molecular formula C41H56N4O4 and a molecular weight of 668.92 g/mol. Its IUPAC name is N-[3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-piperazin-1-ylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide.
| Compound Name | N-[3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-piperazin-1-ylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 67092953 |
| Molecular Formula | C41H56N4O4 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | N-[3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-piperazin-1-ylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCC(CNC(=O)C1=CC(=O)C(C)(c2ccccc2)O1)N1CCNCC1 |
| InChI | InChI=1S/C41H56N4O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-39(47)43-33-36(45-30-28-42-29-31-45)34-44-40(48)37-32-38(46)41(2,49-37)35-25-22-21-23-26-35/h4-5,7-8,10-11,13-14,16-17,19-23,25-26,32,36,42H,3,6,9,12,15,18,24,27-31,33-34H2,1-2H3,(H,43,47)(H,44,48)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | RIPFVZBHPWGXTN-JDPCYWKWSA-N |
| XLogP | 6.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|