C32H41N3O4 — CID 123896576
4-[[6-[(docosa-4,7,10,13,16,19-hexaenoylamino)methyl]-2-pyridinyl]amino]-4-oxobut-2-enoic acid (PubChem CID 123896576) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is 4-[[6-[(docosa-4,7,10,13,16,19-hexaenoylamino)methyl]-2-pyridinyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[6-[(docosa-4,7,10,13,16,19-hexaenoylamino)methyl]-2-pyridinyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 123896576 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 4-[[6-[(docosa-4,7,10,13,16,19-hexaenoylamino)methyl]-2-pyridinyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCc1cccc(NC(=O)C=CC(=O)O)n1 |
| InChI | InChI=1S/C32H41N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-30(36)33-27-28-22-21-23-29(34-28)35-31(37)25-26-32(38)39/h3-4,6-7,9-10,12-13,15-16,18-19,21-23,25-26H,2,5,8,11,14,17,20,24,27H2,1H3,(H,33,36)(H,38,39)(H,34,35,37) |
| InChIKey | GDIZUNSUIJKWIQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|