C13H11N3O6 — CID 92856187
(Z)-4-[[6-[[(E)-3-carboxyprop-2-enoyl]amino]-2-pyridinyl]amino]-4-oxobut-2-enoic acid (PubChem CID 92856187) has the molecular formula C13H11N3O6 and a molecular weight of 305.25 g/mol. Its IUPAC name is (Z)-4-[[6-[[(E)-3-carboxyprop-2-enoyl]amino]-2-pyridinyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[[6-[[(E)-3-carboxyprop-2-enoyl]amino]-2-pyridinyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 92856187 |
| Molecular Formula | C13H11N3O6 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (Z)-4-[[6-[[(E)-3-carboxyprop-2-enoyl]amino]-2-pyridinyl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1cccc(NC(=O)/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C13H11N3O6/c17-10(4-6-12(19)20)15-8-2-1-3-9(14-8)16-11(18)5-7-13(21)22/h1-7H,(H,19,20)(H,21,22)(H2,14,15,16,17,18)/b6-4-,7-5+ |
| InChIKey | LZQLSHORWWMPCB-XGXWUAJZSA-N |
| XLogP | 0.24 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|