C12H10N4O7 — CID 135478679
(E)-4-[[2-[[(Z)-3-carboxyprop-2-enoyl]amino]-6-oxo-1H-pyrimidin-4-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 135478679) has the molecular formula C12H10N4O7 and a molecular weight of 322.23 g/mol. Its IUPAC name is (E)-4-[[2-[[(Z)-3-carboxyprop-2-enoyl]amino]-6-oxo-1H-pyrimidin-4-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[2-[[(Z)-3-carboxyprop-2-enoyl]amino]-6-oxo-1H-pyrimidin-4-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 135478679 |
| Molecular Formula | C12H10N4O7 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (E)-4-[[2-[[(Z)-3-carboxyprop-2-enoyl]amino]-6-oxo-1H-pyrimidin-4-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1nc(NC(=O)/C=C/C(=O)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H10N4O7/c17-7(1-3-10(20)21)13-6-5-9(19)16-12(14-6)15-8(18)2-4-11(22)23/h1-5H,(H,20,21)(H,22,23)(H3,13,14,15,16,17,18,19)/b3-1+,4-2- |
| InChIKey | VPJMBHBKJSBBMT-TZFCGSKZSA-N |
| XLogP | -1.07 |
| TPSA | 178.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|