C11H7ClN2O3S — CID 1389052
(E)-4-[(5-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 1389052) has the molecular formula C11H7ClN2O3S and a molecular weight of 282.71 g/mol. Its IUPAC name is (E)-4-[(5-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(5-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 1389052 |
| Molecular Formula | C11H7ClN2O3S |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | (E)-4-[(5-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H7ClN2O3S/c12-6-1-2-8-7(5-6)13-11(18-8)14-9(15)3-4-10(16)17/h1-5H,(H,16,17)(H,13,14,15)/b4-3+ |
| InChIKey | XXESFNVXFMPBSQ-ONEGZZNKSA-N |
| XLogP | 2.53 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|