C12H7ClN2O2S — CID 16764509
N-(5-chloro-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 16764509) has the molecular formula C12H7ClN2O2S and a molecular weight of 278.72 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(5-chloro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 16764509 |
| Molecular Formula | C12H7ClN2O2S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | N-(5-chloro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1nc2cc(Cl)ccc2s1)c1ccco1 |
| InChI | InChI=1S/C12H7ClN2O2S/c13-7-3-4-10-8(6-7)14-12(18-10)15-11(16)9-2-1-5-17-9/h1-6H,(H,14,15,16) |
| InChIKey | BSUXILMTPFJUFP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |