C19H12IN3O3S — CID 17127294
N-[6-[(4-iodobenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide (PubChem CID 17127294) has the molecular formula C19H12IN3O3S and a molecular weight of 489.29 g/mol. Its IUPAC name is N-[6-[(4-iodobenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[6-[(4-iodobenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17127294 |
| Molecular Formula | C19H12IN3O3S |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 488.96 |
| IUPAC Name | N-[6-[(4-iodobenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(NC(=O)c3ccco3)sc2c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H12IN3O3S/c20-12-5-3-11(4-6-12)17(24)21-13-7-8-14-16(10-13)27-19(22-14)23-18(25)15-2-1-9-26-15/h1-10H,(H,21,24)(H,22,23,25) |
| InChIKey | PNYXIFNTMOZTQG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|