C21H17N3O4S — CID 9193366
N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9193366) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9193366 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(NC(=O)c4ccco4)cc3)sc2c1 |
| InChI | InChI=1S/C21H17N3O4S/c1-2-27-15-9-10-16-18(12-15)29-21(23-16)24-19(25)13-5-7-14(8-6-13)22-20(26)17-4-3-11-28-17/h3-12H,2H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | SGJSCRRDROTPPK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |