C15H14N2O3S — CID 19213737
N-(6-propoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 19213737) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(6-propoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(6-propoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19213737 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(6-propoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | CCCOc1ccc2nc(NC(=O)c3ccco3)sc2c1 |
| InChI | InChI=1S/C15H14N2O3S/c1-2-7-19-10-5-6-11-13(9-10)21-15(16-11)17-14(18)12-4-3-8-20-12/h3-6,8-9H,2,7H2,1H3,(H,16,17,18) |
| InChIKey | YQMLZKZYFGOMTQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |