C15H12N2O4S — CID 646260
ethyl 2-(furan-2-carbonylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 646260) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is ethyl 2-(furan-2-carbonylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(furan-2-carbonylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 646260 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | ethyl 2-(furan-2-carbonylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)c3ccco3)sc2c1 |
| InChI | InChI=1S/C15H12N2O4S/c1-2-20-14(19)9-5-6-10-12(8-9)22-15(16-10)17-13(18)11-4-3-7-21-11/h3-8H,2H2,1H3,(H,16,17,18) |
| InChIKey | WOUSKEGPVJGDDQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |