C18H14N4O7S — CID 108739184
ethyl 2-[(4-methyl-3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 108739184) has the molecular formula C18H14N4O7S and a molecular weight of 430.40 g/mol. Its IUPAC name is ethyl 2-[(4-methyl-3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[(4-methyl-3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 108739184 |
| Molecular Formula | C18H14N4O7S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | ethyl 2-[(4-methyl-3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)c3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C18H14N4O7S/c1-3-29-17(24)10-4-5-12-15(8-10)30-18(19-12)20-16(23)11-6-13(21(25)26)9(2)14(7-11)22(27)28/h4-8H,3H2,1-2H3,(H,19,20,23) |
| InChIKey | WPJPYNXHBXBERG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 154.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|