C15H18N2O4S — CID 108739192
ethyl 2-(butoxycarbonylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 108739192) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is ethyl 2-(butoxycarbonylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(butoxycarbonylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 108739192 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | ethyl 2-(butoxycarbonylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)Nc1nc2ccc(C(=O)OCC)cc2s1 |
| InChI | InChI=1S/C15H18N2O4S/c1-3-5-8-21-15(19)17-14-16-11-7-6-10(9-12(11)22-14)13(18)20-4-2/h6-7,9H,3-5,8H2,1-2H3,(H,16,17,19) |
| InChIKey | CMXRALCGIZRBNI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|