C17H16N2O3S2 — CID 17127785
butyl 2-(thiophene-2-carbonylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 17127785) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is butyl 2-(thiophene-2-carbonylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | butyl 2-(thiophene-2-carbonylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17127785 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | butyl 2-(thiophene-2-carbonylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(NC(=O)c3cccs3)sc2c1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-2-3-8-22-16(21)11-6-7-12-14(10-11)24-17(18-12)19-15(20)13-5-4-9-23-13/h4-7,9-10H,2-3,8H2,1H3,(H,18,19,20) |
| InChIKey | SVOMWBYBOGSCCD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|