C19H16ClIN2O3S — CID 17127730
butyl 2-[(2-chloro-5-iodobenzoyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17127730) has the molecular formula C19H16ClIN2O3S and a molecular weight of 514.77 g/mol. Its IUPAC name is butyl 2-[(2-chloro-5-iodobenzoyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | butyl 2-[(2-chloro-5-iodobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17127730 |
| Molecular Formula | C19H16ClIN2O3S |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 513.96 |
| IUPAC Name | butyl 2-[(2-chloro-5-iodobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(NC(=O)c3cc(I)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C19H16ClIN2O3S/c1-2-3-8-26-18(25)11-4-7-15-16(9-11)27-19(22-15)23-17(24)13-10-12(21)5-6-14(13)20/h4-7,9-10H,2-3,8H2,1H3,(H,22,23,24) |
| InChIKey | KVKSKJJBKICNOJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|