C19H16ClN3O5S — CID 17127781
butyl 2-[(2-chloro-4-nitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17127781) has the molecular formula C19H16ClN3O5S and a molecular weight of 433.87 g/mol. Its IUPAC name is butyl 2-[(2-chloro-4-nitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | butyl 2-[(2-chloro-4-nitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17127781 |
| Molecular Formula | C19H16ClN3O5S |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | butyl 2-[(2-chloro-4-nitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)sc2c1 |
| InChI | InChI=1S/C19H16ClN3O5S/c1-2-3-8-28-18(25)11-4-7-15-16(9-11)29-19(21-15)22-17(24)13-6-5-12(23(26)27)10-14(13)20/h4-7,9-10H,2-3,8H2,1H3,(H,21,22,24) |
| InChIKey | FXXRVVPACZDNIK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|