C21H21N5O7S — CID 3644007
2-(diethylamino)ethyl 2-[(3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 3644007) has the molecular formula C21H21N5O7S and a molecular weight of 487.49 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-[(3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | 2-(diethylamino)ethyl 2-[(3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3644007 |
| Molecular Formula | C21H21N5O7S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-(diethylamino)ethyl 2-[(3,5-dinitrobenzoyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCN(CC)CCOC(=O)c1ccc2nc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C21H21N5O7S/c1-3-24(4-2)7-8-33-20(28)13-5-6-17-18(11-13)34-21(22-17)23-19(27)14-9-15(25(29)30)12-16(10-14)26(31)32/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,22,23,27) |
| InChIKey | GOBMZODKXDXDQN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 157.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|