C16H8F3N3O5S — CID 166127485
2-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 166127485) has the molecular formula C16H8F3N3O5S and a molecular weight of 411.32 g/mol. Its IUPAC name is 2-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 166127485 |
| Molecular Formula | C16H8F3N3O5S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NC(=O)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)sc2c1 |
| InChI | InChI=1S/C16H8F3N3O5S/c17-16(18,19)9-3-8(4-10(6-9)22(26)27)13(23)21-15-20-11-2-1-7(14(24)25)5-12(11)28-15/h1-6H,(H,24,25)(H,20,21,23) |
| InChIKey | SXFYBAPMSAOWJN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|