2-benzamido-1,3-benzothiazole-6-carboxylic acid

C15H10N2O3S — CID 19622650

IUPAC2-benzamido-1,3-benzothiazole-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(NC(=O)c3ccccc3)sc2c1
InChIInChI=1S/C15H10N2O3S/c18-13(9-4-2-1-3-5-9)17-15-16-11-7-6-10(14(19)20)8-12(11)21-15/h1-8H,(H,19,20)(H,16,17,18)
InChIKeyREHLLTKTXBWDMD-UHFFFAOYSA-N
MW298.32 g/mol
LogP3.25
Rot. Bonds3

About 2-benzamido-1,3-benzothiazole-6-carboxylic acid

2-benzamido-1,3-benzothiazole-6-carboxylic acid (PubChem CID 19622650) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-benzamido-1,3-benzothiazole-6-carboxylic acid.

Molecular Properties

Compound Name2-benzamido-1,3-benzothiazole-6-carboxylic acid
PubChem CID19622650
Molecular FormulaC15H10N2O3S
Molecular Weight298.32 g/mol
Exact Mass298.04
IUPAC Name2-benzamido-1,3-benzothiazole-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(NC(=O)c3ccccc3)sc2c1
InChIInChI=1S/C15H10N2O3S/c18-13(9-4-2-1-3-5-9)17-15-16-11-7-6-10(14(19)20)8-12(11)21-15/h1-8H,(H,19,20)(H,16,17,18)
InChIKeyREHLLTKTXBWDMD-UHFFFAOYSA-N
XLogP3.25
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.32
LogP ≤ 53.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-benzamido-1,3-benzothiazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzamido-1,3-benzothiazole-6-carboxylic acid?
The IUPAC name of 2-benzamido-1,3-benzothiazole-6-carboxylic acid (CID 19622650) is 2-benzamido-1,3-benzothiazole-6-carboxylic acid.
What is the SMILES notation for 2-benzamido-1,3-benzothiazole-6-carboxylic acid?
The canonical SMILES for 2-benzamido-1,3-benzothiazole-6-carboxylic acid is O=C(O)c1ccc2nc(NC(=O)c3ccccc3)sc2c1.
What is the InChIKey of 2-benzamido-1,3-benzothiazole-6-carboxylic acid?
The InChIKey is REHLLTKTXBWDMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3S/c18-13(9-4-2-1-3-5-9)17-15-16-11-7-6-10(14(19)20)8-12(11)21-15/h1-8H,(H,19,20)(H,16,17,18).
What are the key properties of 2-benzamido-1,3-benzothiazole-6-carboxylic acid?
2-benzamido-1,3-benzothiazole-6-carboxylic acid has a molecular weight of 298.32 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-1,3-benzothiazole-6-carboxylic acid is sourced from PubChem (CID 19622650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).