C15H10N2O3S — CID 19622650
2-benzamido-1,3-benzothiazole-6-carboxylic acid (PubChem CID 19622650) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-benzamido-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-benzamido-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 19622650 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-benzamido-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NC(=O)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C15H10N2O3S/c18-13(9-4-2-1-3-5-9)17-15-16-11-7-6-10(14(19)20)8-12(11)21-15/h1-8H,(H,19,20)(H,16,17,18) |
| InChIKey | REHLLTKTXBWDMD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |