C21H14N2O3S — CID 86658020
(2-benzamido-1,3-benzothiazol-6-yl) benzoate (PubChem CID 86658020) has the molecular formula C21H14N2O3S and a molecular weight of 374.42 g/mol. Its IUPAC name is (2-benzamido-1,3-benzothiazol-6-yl) benzoate.
| Compound Name | (2-benzamido-1,3-benzothiazol-6-yl) benzoate |
|---|---|
| PubChem CID | 86658020 |
| Molecular Formula | C21H14N2O3S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (2-benzamido-1,3-benzothiazol-6-yl) benzoate |
| SMILES | O=C(Nc1nc2ccc(OC(=O)c3ccccc3)cc2s1)c1ccccc1 |
| InChI | InChI=1S/C21H14N2O3S/c24-19(14-7-3-1-4-8-14)23-21-22-17-12-11-16(13-18(17)27-21)26-20(25)15-9-5-2-6-10-15/h1-13H,(H,22,23,24) |
| InChIKey | USACNPYXONQHJH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|