C19H13N3O2S — CID 2090733
N-(6-phenoxy-1,3-benzothiazol-2-yl)pyridine-4-carboxamide (PubChem CID 2090733) has the molecular formula C19H13N3O2S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(6-phenoxy-1,3-benzothiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | N-(6-phenoxy-1,3-benzothiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2090733 |
| Molecular Formula | C19H13N3O2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(6-phenoxy-1,3-benzothiazol-2-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc(Oc3ccccc3)cc2s1)c1ccncc1 |
| InChI | InChI=1S/C19H13N3O2S/c23-18(13-8-10-20-11-9-13)22-19-21-16-7-6-15(12-17(16)25-19)24-14-4-2-1-3-5-14/h1-12H,(H,21,22,23) |
| InChIKey | YWWPGHMDHMFQFI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |