C21H13N3O2S — CID 7948379
3-cyano-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7948379) has the molecular formula C21H13N3O2S and a molecular weight of 371.42 g/mol. Its IUPAC name is 3-cyano-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-cyano-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7948379 |
| Molecular Formula | C21H13N3O2S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-cyano-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2nc3ccc(Oc4ccccc4)cc3s2)c1 |
| InChI | InChI=1S/C21H13N3O2S/c22-13-14-5-4-6-15(11-14)20(25)24-21-23-18-10-9-17(12-19(18)27-21)26-16-7-2-1-3-8-16/h1-12H,(H,23,24,25) |
| InChIKey | COKNZNSVLXAVAD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |