C21H15N3O4S — CID 7948430
3-methyl-4-nitro-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7948430) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 3-methyl-4-nitro-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-methyl-4-nitro-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7948430 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-methyl-4-nitro-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2nc3ccc(Oc4ccccc4)cc3s2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15N3O4S/c1-13-11-14(7-10-18(13)24(26)27)20(25)23-21-22-17-9-8-16(12-19(17)29-21)28-15-5-3-2-4-6-15/h2-12H,1H3,(H,22,23,25) |
| InChIKey | YTIJIJHXHSMKDU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|