C22H19N3O4S2 — CID 4800277
3-(dimethylsulfamoyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4800277) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4800277 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)Nc2nc3ccc(Oc4ccccc4)cc3s2)c1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-25(2)31(27,28)18-10-6-7-15(13-18)21(26)24-22-23-19-12-11-17(14-20(19)30-22)29-16-8-4-3-5-9-16/h3-14H,1-2H3,(H,23,24,26) |
| InChIKey | UHCKHDNTFDPDIS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |