C16H14N4O5S2 — CID 4075249
N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide (PubChem CID 4075249) has the molecular formula C16H14N4O5S2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4075249 |
| Molecular Formula | C16H14N4O5S2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2nc(NC(=O)c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C16H14N4O5S2/c1-19(2)27(24,25)12-6-7-13-14(9-12)26-16(17-13)18-15(21)10-4-3-5-11(8-10)20(22)23/h3-9H,1-2H3,(H,17,18,21) |
| InChIKey | VTBMSOAWRCLYFZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|