C20H24N4O5S3 — CID 20932189
4-(diethylsulfamoyl)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 20932189) has the molecular formula C20H24N4O5S3 and a molecular weight of 496.64 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 20932189 |
| Molecular Formula | C20H24N4O5S3 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nc3ccc(S(=O)(=O)N(C)C)cc3s2)cc1 |
| InChI | InChI=1S/C20H24N4O5S3/c1-5-24(6-2)32(28,29)15-9-7-14(8-10-15)19(25)22-20-21-17-12-11-16(13-18(17)30-20)31(26,27)23(3)4/h7-13H,5-6H2,1-4H3,(H,21,22,25) |
| InChIKey | HVILJGVCYHTGFI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |