C20H22ClN3O3S2 — CID 4119592
4-[butyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4119592) has the molecular formula C20H22ClN3O3S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 4-[butyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[butyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4119592 |
| Molecular Formula | C20H22ClN3O3S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-[butyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S2/c1-3-5-12-24(4-2)29(26,27)16-9-6-14(7-10-16)19(25)23-20-22-17-11-8-15(21)13-18(17)28-20/h6-11,13H,3-5,12H2,1-2H3,(H,22,23,25) |
| InChIKey | QAODCXMRNJXMPY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |