C20H23N3O3S2 — CID 8873954
4-(diethylsulfamoyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 8873954) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8873954 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCc1ccc2nc(NC(=O)c3ccc(S(=O)(=O)N(CC)CC)cc3)sc2c1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-4-14-7-12-17-18(13-14)27-20(21-17)22-19(24)15-8-10-16(11-9-15)28(25,26)23(5-2)6-3/h7-13H,4-6H2,1-3H3,(H,21,22,24) |
| InChIKey | XRIONMCOGSTJIN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |