C25H25N3O5S2 — CID 41007497
4-[benzyl(ethyl)sulfamoyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41007497) has the molecular formula C25H25N3O5S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41007497 |
| Molecular Formula | C25H25N3O5S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nc3cc(OC)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C25H25N3O5S2/c1-4-28(16-17-8-6-5-7-9-17)35(30,31)19-12-10-18(11-13-19)24(29)27-25-26-20-14-21(32-2)22(33-3)15-23(20)34-25/h5-15H,4,16H2,1-3H3,(H,26,27,29) |
| InChIKey | BNLQYYKOXBZCRJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |