C23H20ClN3O3S2 — CID 4583357
4-[benzyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4583357) has the molecular formula C23H20ClN3O3S2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4583357 |
| Molecular Formula | C23H20ClN3O3S2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C23H20ClN3O3S2/c1-2-27(15-16-6-4-3-5-7-16)32(29,30)19-11-8-17(9-12-19)22(28)26-23-25-20-13-10-18(24)14-21(20)31-23/h3-14H,2,15H2,1H3,(H,25,26,28) |
| InChIKey | RRAIIIDIVDIJEN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |