C26H25N3O4S2 — CID 4671611
N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(4-methylbenzoyl)benzamide (PubChem CID 4671611) has the molecular formula C26H25N3O4S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(4-methylbenzoyl)benzamide.
| Compound Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(4-methylbenzoyl)benzamide |
|---|---|
| PubChem CID | 4671611 |
| Molecular Formula | C26H25N3O4S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(4-methylbenzoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NC(=O)c3ccccc3C(=O)c3ccc(C)cc3)sc2c1 |
| InChI | InChI=1S/C26H25N3O4S2/c1-4-29(5-2)35(32,33)19-14-15-22-23(16-19)34-26(27-22)28-25(31)21-9-7-6-8-20(21)24(30)18-12-10-17(3)11-13-18/h6-16H,4-5H2,1-3H3,(H,27,28,31) |
| InChIKey | CHNCWFKIXIFGTA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |