C25H21ClN4O6S2 — CID 4106258
2-(4-chloro-3-nitrobenzoyl)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 4106258) has the molecular formula C25H21ClN4O6S2 and a molecular weight of 573.05 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrobenzoyl)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 2-(4-chloro-3-nitrobenzoyl)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4106258 |
| Molecular Formula | C25H21ClN4O6S2 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 2-(4-chloro-3-nitrobenzoyl)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NC(=O)c3ccccc3C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C25H21ClN4O6S2/c1-3-29(4-2)38(35,36)16-10-12-20-22(14-16)37-25(27-20)28-24(32)18-8-6-5-7-17(18)23(31)15-9-11-19(26)21(13-15)30(33)34/h5-14H,3-4H2,1-2H3,(H,27,28,32) |
| InChIKey | HREXWSIWLODUJI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|