C22H25ClN4O5S2 — CID 5130406
4-chloro-N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide (PubChem CID 5130406) has the molecular formula C22H25ClN4O5S2 and a molecular weight of 525.05 g/mol. Its IUPAC name is 4-chloro-N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5130406 |
| Molecular Formula | C22H25ClN4O5S2 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 4-chloro-N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-nitrobenzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc2nc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C22H25ClN4O5S2/c1-3-5-11-26(12-6-4-2)34(31,32)16-8-10-18-20(14-16)33-22(24-18)25-21(28)15-7-9-17(23)19(13-15)27(29)30/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,24,25,28) |
| InChIKey | BOPXIYGKXVUTDH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|