C24H32N4O3S2 — CID 5075791
N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(dimethylamino)benzamide (PubChem CID 5075791) has the molecular formula C24H32N4O3S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(dimethylamino)benzamide.
| Compound Name | N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 5075791 |
| Molecular Formula | C24H32N4O3S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[6-(dibutylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(dimethylamino)benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc2nc(NC(=O)c3cccc(N(C)C)c3)sc2c1 |
| InChI | InChI=1S/C24H32N4O3S2/c1-5-7-14-28(15-8-6-2)33(30,31)20-12-13-21-22(17-20)32-24(25-21)26-23(29)18-10-9-11-19(16-18)27(3)4/h9-13,16-17H,5-8,14-15H2,1-4H3,(H,25,26,29) |
| InChIKey | JAAJXMZMMGNBHP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |